C10H14BrN3 — CID 79718817
1-(5-bromo-3-methyl-2-pyridinyl)pyrrolidin-3-amine (PubChem CID 79718817) has the molecular formula C10H14BrN3 and a molecular weight of 256.15 g/mol. Its IUPAC name is 1-(5-bromo-3-methyl-2-pyridinyl)pyrrolidin-3-amine.
| Compound Name | 1-(5-bromo-3-methyl-2-pyridinyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 79718817 |
| Molecular Formula | C10H14BrN3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 1-(5-bromo-3-methyl-2-pyridinyl)pyrrolidin-3-amine |
| SMILES | Cc1cc(Br)cnc1N1CCC(N)C1 |
| InChI | InChI=1S/C10H14BrN3/c1-7-4-8(11)5-13-10(7)14-3-2-9(12)6-14/h4-5,9H,2-3,6,12H2,1H3 |
| InChIKey | JDJQQUNDKOOQLQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |