C11H14BrClN2O — CID 81210904
4-(5-bromo-3-methyl-2-pyridinyl)-2-(chloromethyl)morpholine (PubChem CID 81210904) has the molecular formula C11H14BrClN2O and a molecular weight of 305.60 g/mol. Its IUPAC name is 4-(5-bromo-3-methyl-2-pyridinyl)-2-(chloromethyl)morpholine.
| Compound Name | 4-(5-bromo-3-methyl-2-pyridinyl)-2-(chloromethyl)morpholine |
|---|---|
| PubChem CID | 81210904 |
| Molecular Formula | C11H14BrClN2O |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 4-(5-bromo-3-methyl-2-pyridinyl)-2-(chloromethyl)morpholine |
| SMILES | Cc1cc(Br)cnc1N1CCOC(CCl)C1 |
| InChI | InChI=1S/C11H14BrClN2O/c1-8-4-9(12)6-14-11(8)15-2-3-16-10(5-13)7-15/h4,6,10H,2-3,5,7H2,1H3 |
| InChIKey | SCHKBGUANXDAQC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|