C15H21ClN2O4 — CID 4670659
2-chloro-1-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 4670659) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-chloro-1-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4670659 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-chloro-1-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1cc(N2CCN(C(=O)CCl)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C15H21ClN2O4/c1-20-12-8-11(9-13(21-2)15(12)22-3)17-4-6-18(7-5-17)14(19)10-16/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | OYSVJASQRHEAGE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|