C18H29N3O4 — CID 113110457
N-tert-butyl-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 113110457) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-tert-butyl-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113110457 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-tert-butyl-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1cc(N2CCN(C(=O)NC(C)(C)C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H29N3O4/c1-18(2,3)19-17(22)21-9-7-20(8-10-21)13-11-14(23-4)16(25-6)15(12-13)24-5/h11-12H,7-10H2,1-6H3,(H,19,22) |
| InChIKey | PEUXGASNTUTCFX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|