C20H24BrN3O4 — CID 23991152
N-(3-bromophenyl)-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 23991152) has the molecular formula C20H24BrN3O4 and a molecular weight of 450.33 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-(3-bromophenyl)-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 23991152 |
| Molecular Formula | C20H24BrN3O4 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-(3-bromophenyl)-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1cc(N2CCN(C(=O)Nc3cccc(Br)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H24BrN3O4/c1-26-17-12-16(13-18(27-2)19(17)28-3)23-7-9-24(10-8-23)20(25)22-15-6-4-5-14(21)11-15/h4-6,11-13H,7-10H2,1-3H3,(H,22,25) |
| InChIKey | FWOXFCRQERIZNF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|