C18H22N4O3 — CID 86986916
N-(3,4-dimethoxyphenyl)-4-pyridin-4-ylpiperazine-1-carboxamide (PubChem CID 86986916) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-pyridin-4-ylpiperazine-1-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-pyridin-4-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 86986916 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-pyridin-4-ylpiperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3ccncc3)CC2)cc1OC |
| InChI | InChI=1S/C18H22N4O3/c1-24-16-4-3-14(13-17(16)25-2)20-18(23)22-11-9-21(10-12-22)15-5-7-19-8-6-15/h3-8,13H,9-12H2,1-2H3,(H,20,23) |
| InChIKey | RTOLNNQPMQBSMO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |