C20H25N3O3 — CID 113111056
N-(3,4-dimethoxyphenyl)-4-(2-methylphenyl)piperazine-1-carboxamide (PubChem CID 113111056) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-(2-methylphenyl)piperazine-1-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-(2-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113111056 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-(2-methylphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3ccccc3C)CC2)cc1OC |
| InChI | InChI=1S/C20H25N3O3/c1-15-6-4-5-7-17(15)22-10-12-23(13-11-22)20(24)21-16-8-9-18(25-2)19(14-16)26-3/h4-9,14H,10-13H2,1-3H3,(H,21,24) |
| InChIKey | RENIGRXVLVMEFQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |