C13H16Cl2N2O2 — CID 134069379
2-chloro-1-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 134069379) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 2-chloro-1-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 134069379 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-chloro-1-[4-(5-chloro-2-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(Cl)cc1N1CCN(C(=O)CCl)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-19-12-3-2-10(15)8-11(12)16-4-6-17(7-5-16)13(18)9-14/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | UXJLRCLVVSSSEF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|