C14H19ClN2O3 — CID 4740944
2-chloro-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 4740944) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-chloro-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4740944 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-chloro-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CCl)CC2)cc1OC |
| InChI | InChI=1S/C14H19ClN2O3/c1-19-12-4-3-11(9-13(12)20-2)16-5-7-17(8-6-16)14(18)10-15/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | RKRBURNJMZAMHR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|