C14H18Cl2N2O — CID 91465258
2-chloro-1-[4-(4-chloro-3-ethylphenyl)piperazin-1-yl]ethanone (PubChem CID 91465258) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 2-chloro-1-[4-(4-chloro-3-ethylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(4-chloro-3-ethylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 91465258 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-chloro-1-[4-(4-chloro-3-ethylphenyl)piperazin-1-yl]ethanone |
| SMILES | CCc1cc(N2CCN(C(=O)CCl)CC2)ccc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O/c1-2-11-9-12(3-4-13(11)16)17-5-7-18(8-6-17)14(19)10-15/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | GPKZCJNIWJQWOJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|