C18H29N3O3 — CID 113110884
4-(3,4-dimethoxyphenyl)-N-pentylpiperazine-1-carboxamide (PubChem CID 113110884) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-pentylpiperazine-1-carboxamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-pentylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 113110884 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-pentylpiperazine-1-carboxamide |
| SMILES | CCCCCNC(=O)N1CCN(c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C18H29N3O3/c1-4-5-6-9-19-18(22)21-12-10-20(11-13-21)15-7-8-16(23-2)17(14-15)24-3/h7-8,14H,4-6,9-13H2,1-3H3,(H,19,22) |
| InChIKey | KSZMHAYLJVCXEI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|