C22H29N3O4 — CID 113109461
4-(3,4-dimethoxyphenyl)-N-[2-(3-methoxyphenyl)ethyl]piperazine-1-carboxamide (PubChem CID 113109461) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-[2-(3-methoxyphenyl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-[2-(3-methoxyphenyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109461 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-[2-(3-methoxyphenyl)ethyl]piperazine-1-carboxamide |
| SMILES | COc1cccc(CCNC(=O)N2CCN(c3ccc(OC)c(OC)c3)CC2)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-27-19-6-4-5-17(15-19)9-10-23-22(26)25-13-11-24(12-14-25)18-7-8-20(28-2)21(16-18)29-3/h4-8,15-16H,9-14H2,1-3H3,(H,23,26) |
| InChIKey | HTIOKMXPCDQNRY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|