C20H25N3O3 — CID 110363825
N-benzyl-4-(3,4-dimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 110363825) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-benzyl-4-(3,4-dimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-(3,4-dimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110363825 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-benzyl-4-(3,4-dimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)NCc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C20H25N3O3/c1-25-18-9-8-17(14-19(18)26-2)22-10-12-23(13-11-22)20(24)21-15-16-6-4-3-5-7-16/h3-9,14H,10-13,15H2,1-2H3,(H,21,24) |
| InChIKey | LMXGUUVBWSIAKB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|