C16H23ClN2O4 — CID 10759766
2-chloro-1-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 10759766) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is 2-chloro-1-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 10759766 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-chloro-1-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | COc1cc(CN2CCN(C(=O)CCl)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C16H23ClN2O4/c1-21-13-8-12(9-14(22-2)16(13)23-3)11-18-4-6-19(7-5-18)15(20)10-17/h8-9H,4-7,10-11H2,1-3H3 |
| InChIKey | VNVBVNFLEXJYRM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|