C16H25ClN2O3S2 — CID 19983175
methyl 4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbodithioate;hydrochloride (PubChem CID 19983175) has the molecular formula C16H25ClN2O3S2 and a molecular weight of 392.97 g/mol. Its IUPAC name is methyl 4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbodithioate;hydrochloride.
| Compound Name | methyl 4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbodithioate;hydrochloride |
|---|---|
| PubChem CID | 19983175 |
| Molecular Formula | C16H25ClN2O3S2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | methyl 4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbodithioate;hydrochloride |
| SMILES | COc1cc(CN2CCN(C(=S)SC)CC2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C16H24N2O3S2.ClH/c1-19-13-9-12(10-14(20-2)15(13)21-3)11-17-5-7-18(8-6-17)16(22)23-4;/h9-10H,5-8,11H2,1-4H3;1H |
| InChIKey | DLEWAFNUUBHSHL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|