C21H36N4O3S — CID 109413935
N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 109413935) has the molecular formula C21H36N4O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109413935 |
| Molecular Formula | C21H36N4O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)(C)SC)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C21H36N4O3S/c1-21(2,29-7)15-23-20(22-3)25-10-8-24(9-11-25)14-16-12-17(26-4)19(28-6)18(13-16)27-5/h12-13H,8-11,14-15H2,1-7H3,(H,22,23) |
| InChIKey | XPANGWUXRWDAIJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|