C21H32N6O3 — CID 109413595
N'-methyl-N-(2-pyrazol-1-ylethyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 109413595) has the molecular formula C21H32N6O3 and a molecular weight of 416.53 g/mol. Its IUPAC name is N'-methyl-N-(2-pyrazol-1-ylethyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-(2-pyrazol-1-ylethyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109413595 |
| Molecular Formula | C21H32N6O3 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | N'-methyl-N-(2-pyrazol-1-ylethyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCn1cccn1)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C21H32N6O3/c1-22-21(23-7-9-27-8-5-6-24-27)26-12-10-25(11-13-26)16-17-14-18(28-2)20(30-4)19(15-17)29-3/h5-6,8,14-15H,7,9-13,16H2,1-4H3,(H,22,23) |
| InChIKey | WGLIAQLDJKIYMY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|