C20H32IN7O3 — CID 109414003
N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109414003) has the molecular formula C20H32IN7O3 and a molecular weight of 545.43 g/mol. Its IUPAC name is N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109414003 |
| Molecular Formula | C20H32IN7O3 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ncnn1C)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C20H31N7O3.HI/c1-21-20(22-12-18-23-14-24-25(18)2)27-8-6-26(7-9-27)13-15-10-16(28-3)19(30-5)17(11-15)29-4;/h10-11,14H,6-9,12-13H2,1-5H3,(H,21,22);1H |
| InChIKey | YMZBFQJUMRVPIK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|