C22H39IN4O5 — CID 109413731
N-[3-(2-methoxyethoxy)propyl]-N'-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109413731) has the molecular formula C22H39IN4O5 and a molecular weight of 566.48 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-N'-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-N'-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109413731 |
| Molecular Formula | C22H39IN4O5 |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-N'-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCCOC)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C22H38N4O5.HI/c1-23-22(24-7-6-12-31-14-13-27-2)26-10-8-25(9-11-26)17-18-15-19(28-3)21(30-5)20(16-18)29-4;/h15-16H,6-14,17H2,1-5H3,(H,23,24);1H |
| InChIKey | RZDREDLNEZMUSW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|