C23H40N4O4 — CID 109414096
N'-(4-ethoxybutyl)-N-ethyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 109414096) has the molecular formula C23H40N4O4 and a molecular weight of 436.60 g/mol. Its IUPAC name is N'-(4-ethoxybutyl)-N-ethyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-(4-ethoxybutyl)-N-ethyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109414096 |
| Molecular Formula | C23H40N4O4 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | N'-(4-ethoxybutyl)-N-ethyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCOCC)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C23H40N4O4/c1-6-24-23(25-10-8-9-15-31-7-2)27-13-11-26(12-14-27)18-19-16-20(28-3)22(30-5)21(17-19)29-4/h16-17H,6-15,18H2,1-5H3,(H,24,25) |
| InChIKey | LPYXUBSMSKKNHC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|