C24H42IN5O3 — CID 109413543
N'-[2-cyclopropyl-2-(dimethylamino)ethyl]-N-ethyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109413543) has the molecular formula C24H42IN5O3 and a molecular weight of 575.54 g/mol. Its IUPAC name is N'-[2-cyclopropyl-2-(dimethylamino)ethyl]-N-ethyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-cyclopropyl-2-(dimethylamino)ethyl]-N-ethyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109413543 |
| Molecular Formula | C24H42IN5O3 |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | N'-[2-cyclopropyl-2-(dimethylamino)ethyl]-N-ethyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C1CC1)N(C)C)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C24H41N5O3.HI/c1-7-25-24(26-16-20(27(2)3)19-8-9-19)29-12-10-28(11-13-29)17-18-14-21(30-4)23(32-6)22(15-18)31-5;/h14-15,19-20H,7-13,16-17H2,1-6H3,(H,25,26);1H |
| InChIKey | NMTOZLYGWVETEI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|