C22H37IN4O4 — CID 109413778
N-ethyl-N'-[(3-methyloxetan-3-yl)methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109413778) has the molecular formula C22H37IN4O4 and a molecular weight of 548.47 g/mol. Its IUPAC name is N-ethyl-N'-[(3-methyloxetan-3-yl)methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(3-methyloxetan-3-yl)methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109413778 |
| Molecular Formula | C22H37IN4O4 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | N-ethyl-N'-[(3-methyloxetan-3-yl)methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(C)COC1)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C22H36N4O4.HI/c1-6-23-21(24-14-22(2)15-30-16-22)26-9-7-25(8-10-26)13-17-11-18(27-3)20(29-5)19(12-17)28-4;/h11-12H,6-10,13-16H2,1-5H3,(H,23,24);1H |
| InChIKey | GBIRKXGSQRGSCA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|