C23H38IN5O4 — CID 109413560
N-[2-[[ethylamino-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 109413560) has the molecular formula C23H38IN5O4 and a molecular weight of 575.49 g/mol. Its IUPAC name is N-[2-[[ethylamino-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 109413560 |
| Molecular Formula | C23H38IN5O4 |
| Molecular Weight | 575.49 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | N-[2-[[ethylamino-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C1CC1)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C23H37N5O4.HI/c1-5-24-23(26-9-8-25-22(29)18-6-7-18)28-12-10-27(11-13-28)16-17-14-19(30-2)21(32-4)20(15-17)31-3;/h14-15,18H,5-13,16H2,1-4H3,(H,24,26)(H,25,29);1H |
| InChIKey | JEPFDINJFRFJSH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|