C22H37IN4O5 — CID 109413867
methyl 5-[[N-methyl-C-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]carbonimidoyl]amino]pentanoate;hydroiodide (PubChem CID 109413867) has the molecular formula C22H37IN4O5 and a molecular weight of 564.47 g/mol. Its IUPAC name is methyl 5-[[N-methyl-C-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]carbonimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N-methyl-C-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]carbonimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 109413867 |
| Molecular Formula | C22H37IN4O5 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | methyl 5-[[N-methyl-C-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]carbonimidoyl]amino]pentanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCC(=O)OC)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C22H36N4O5.HI/c1-23-22(24-9-7-6-8-20(27)30-4)26-12-10-25(11-13-26)16-17-14-18(28-2)21(31-5)19(15-17)29-3;/h14-15H,6-13,16H2,1-5H3,(H,23,24);1H |
| InChIKey | MDQIMNIIZJRSIL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|