C24H41N5O3 — CID 109413634
N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 109413634) has the molecular formula C24H41N5O3 and a molecular weight of 447.62 g/mol. Its IUPAC name is N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109413634 |
| Molecular Formula | C24H41N5O3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCC1CCN(C)CC1)N1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C24H41N5O3/c1-25-24(26-9-6-19-7-10-27(2)11-8-19)29-14-12-28(13-15-29)18-20-16-21(30-3)23(32-5)22(17-20)31-4/h16-17,19H,6-15,18H2,1-5H3,(H,25,26) |
| InChIKey | JXKVDGBVCLIDCF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|