C15H22N2O3S2 — CID 19388427
methyl 4-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperazine-1-carbodithioate (PubChem CID 19388427) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is methyl 4-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperazine-1-carbodithioate.
| Compound Name | methyl 4-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 19388427 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | methyl 4-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperazine-1-carbodithioate |
| SMILES | COc1cc(CN2CCN(C(=S)SC)CC2)cc(OC)c1O |
| InChI | InChI=1S/C15H22N2O3S2/c1-19-12-8-11(9-13(20-2)14(12)18)10-16-4-6-17(7-5-16)15(21)22-3/h8-9,18H,4-7,10H2,1-3H3 |
| InChIKey | HBJYTRGUZKQGTK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|