C13H19NO4S — CID 82981697
2,6-dimethoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenol (PubChem CID 82981697) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 82981697 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2,6-dimethoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]phenol |
| SMILES | COc1cc(CN2CCS(=O)CC2)cc(OC)c1O |
| InChI | InChI=1S/C13H19NO4S/c1-17-11-7-10(8-12(18-2)13(11)15)9-14-3-5-19(16)6-4-14/h7-8,15H,3-6,9H2,1-2H3 |
| InChIKey | CCJJOLNLHFLWLZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |