C16H24N2O9S — CID 17366102
2,6-dimethoxy-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenol;oxalic acid (PubChem CID 17366102) has the molecular formula C16H24N2O9S and a molecular weight of 420.44 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenol;oxalic acid.
| Compound Name | 2,6-dimethoxy-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenol;oxalic acid |
|---|---|
| PubChem CID | 17366102 |
| Molecular Formula | C16H24N2O9S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2,6-dimethoxy-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenol;oxalic acid |
| SMILES | COc1cc(CN2CCN(S(C)(=O)=O)CC2)cc(OC)c1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H22N2O5S.C2H2O4/c1-20-12-8-11(9-13(21-2)14(12)17)10-15-4-6-16(7-5-15)22(3,18)19;3-1(4)2(5)6/h8-9,17H,4-7,10H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | APMLXAUWDZHJLV-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|