C17H26N2O9S — CID 17366145
1-methylsulfonyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 17366145) has the molecular formula C17H26N2O9S and a molecular weight of 434.47 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-methylsulfonyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 17366145 |
| Molecular Formula | C17H26N2O9S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-methylsulfonyl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | COc1cc(CN2CCN(S(C)(=O)=O)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H24N2O5S.C2H2O4/c1-20-13-9-12(10-14(21-2)15(13)22-3)11-16-5-7-17(8-6-16)23(4,18)19;3-1(4)2(5)6/h9-10H,5-8,11H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | FNUMAHWQRHXTJM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|