C25H32N2O10 — CID 126476745
[4-[(3,5-dimethoxyphenyl)methyl]piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone;oxalic acid (PubChem CID 126476745) has the molecular formula C25H32N2O10 and a molecular weight of 520.54 g/mol. Its IUPAC name is [4-[(3,5-dimethoxyphenyl)methyl]piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone;oxalic acid.
| Compound Name | [4-[(3,5-dimethoxyphenyl)methyl]piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone;oxalic acid |
|---|---|
| PubChem CID | 126476745 |
| Molecular Formula | C25H32N2O10 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [4-[(3,5-dimethoxyphenyl)methyl]piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone;oxalic acid |
| SMILES | COc1cc(CN2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H30N2O6.C2H2O4/c1-27-18-10-16(11-19(14-18)28-2)15-24-6-8-25(9-7-24)23(26)17-12-20(29-3)22(31-5)21(13-17)30-4;3-1(4)2(5)6/h10-14H,6-9,15H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | MPJYIZHIZPCKHI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|