C25H32N2O8 — CID 2927354
oxalic acid;[4-(3-phenylpropyl)piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 2927354) has the molecular formula C25H32N2O8 and a molecular weight of 488.54 g/mol. Its IUPAC name is oxalic acid;[4-(3-phenylpropyl)piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | oxalic acid;[4-(3-phenylpropyl)piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 2927354 |
| Molecular Formula | C25H32N2O8 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | oxalic acid;[4-(3-phenylpropyl)piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCN(CCCc3ccccc3)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H30N2O4.C2H2O4/c1-27-20-16-19(17-21(28-2)22(20)29-3)23(26)25-14-12-24(13-15-25)11-7-10-18-8-5-4-6-9-18;3-1(4)2(5)6/h4-6,8-9,16-17H,7,10-15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | ZRBKVAMISYLROM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|