C25H34N2O7 — CID 90483761
oxalic acid;1-(3-phenylpropyl)-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 90483761) has the molecular formula C25H34N2O7 and a molecular weight of 474.55 g/mol. Its IUPAC name is oxalic acid;1-(3-phenylpropyl)-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | oxalic acid;1-(3-phenylpropyl)-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 90483761 |
| Molecular Formula | C25H34N2O7 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | oxalic acid;1-(3-phenylpropyl)-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(OC)c(OC)cc1CN1CCN(CCCc2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H32N2O3.C2H2O4/c1-26-21-17-23(28-3)22(27-2)16-20(21)18-25-14-12-24(13-15-25)11-7-10-19-8-5-4-6-9-19;3-1(4)2(5)6/h4-6,8-9,16-17H,7,10-15,18H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | WTPOXOAOJOVCCR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|