C21H29N3O4 — CID 163800884
N-hydroxy-4,5-dimethoxy-2-[[4-(2-phenylethyl)piperazin-1-yl]methyl]benzeneamine oxide (PubChem CID 163800884) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-hydroxy-4,5-dimethoxy-2-[[4-(2-phenylethyl)piperazin-1-yl]methyl]benzeneamine oxide.
| Compound Name | N-hydroxy-4,5-dimethoxy-2-[[4-(2-phenylethyl)piperazin-1-yl]methyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163800884 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-hydroxy-4,5-dimethoxy-2-[[4-(2-phenylethyl)piperazin-1-yl]methyl]benzeneamine oxide |
| SMILES | COc1cc(CN2CCN(CCc3ccccc3)CC2)c([NH+]([O-])O)cc1OC |
| InChI | InChI=1S/C21H29N3O4/c1-27-20-14-18(19(24(25)26)15-21(20)28-2)16-23-12-10-22(11-13-23)9-8-17-6-4-3-5-7-17/h3-7,14-15,24-25H,8-13,16H2,1-2H3 |
| InChIKey | NEVNQZZENGDJLB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|