C18H28N4O5 — CID 163616974
N-hydroxy-4,5-dimethoxy-2-[[4-(pyrrolidine-1-carbonyl)piperazin-1-yl]methyl]benzeneamine oxide (PubChem CID 163616974) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-hydroxy-4,5-dimethoxy-2-[[4-(pyrrolidine-1-carbonyl)piperazin-1-yl]methyl]benzeneamine oxide.
| Compound Name | N-hydroxy-4,5-dimethoxy-2-[[4-(pyrrolidine-1-carbonyl)piperazin-1-yl]methyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163616974 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-hydroxy-4,5-dimethoxy-2-[[4-(pyrrolidine-1-carbonyl)piperazin-1-yl]methyl]benzeneamine oxide |
| SMILES | COc1cc(CN2CCN(C(=O)N3CCCC3)CC2)c([NH+]([O-])O)cc1OC |
| InChI | InChI=1S/C18H28N4O5/c1-26-16-11-14(15(22(24)25)12-17(16)27-2)13-19-7-9-21(10-8-19)18(23)20-5-3-4-6-20/h11-12,22,24H,3-10,13H2,1-2H3 |
| InChIKey | HKUQNZTZDMBBBL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|