C14H19ClN2O4 — CID 126840899
methyl 4-[(2-chloro-4-hydroxy-5-methoxyphenyl)methyl]piperazine-1-carboxylate (PubChem CID 126840899) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is methyl 4-[(2-chloro-4-hydroxy-5-methoxyphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(2-chloro-4-hydroxy-5-methoxyphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 126840899 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | methyl 4-[(2-chloro-4-hydroxy-5-methoxyphenyl)methyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(Cc2cc(OC)c(O)cc2Cl)CC1 |
| InChI | InChI=1S/C14H19ClN2O4/c1-20-13-7-10(11(15)8-12(13)18)9-16-3-5-17(6-4-16)14(19)21-2/h7-8,18H,3-6,9H2,1-2H3 |
| InChIKey | WHXQGTSRWGTRPF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |