C20H25ClN2O3 — CID 29180657
5-chloro-2-methoxy-4-[[(3R)-3-(4-methoxyanilino)piperidin-1-yl]methyl]phenol (PubChem CID 29180657) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-[[(3R)-3-(4-methoxyanilino)piperidin-1-yl]methyl]phenol.
| Compound Name | 5-chloro-2-methoxy-4-[[(3R)-3-(4-methoxyanilino)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 29180657 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 5-chloro-2-methoxy-4-[[(3R)-3-(4-methoxyanilino)piperidin-1-yl]methyl]phenol |
| SMILES | COc1ccc(N[C@@H]2CCCN(Cc3cc(OC)c(O)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-25-17-7-5-15(6-8-17)22-16-4-3-9-23(13-16)12-14-10-20(26-2)19(24)11-18(14)21/h5-8,10-11,16,22,24H,3-4,9,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | SDYZWYMNLQJXRY-MRXNPFEDSA-N |
| XLogP | 4.14 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|