C18H24N4O2 — CID 172891896
N-[1-[(2,5-dimethoxyphenyl)methyl]piperidin-3-yl]pyrimidin-2-amine (PubChem CID 172891896) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[1-[(2,5-dimethoxyphenyl)methyl]piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | N-[1-[(2,5-dimethoxyphenyl)methyl]piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 172891896 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-[1-[(2,5-dimethoxyphenyl)methyl]piperidin-3-yl]pyrimidin-2-amine |
| SMILES | COc1ccc(OC)c(CN2CCCC(Nc3ncccn3)C2)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-23-16-6-7-17(24-2)14(11-16)12-22-10-3-5-15(13-22)21-18-19-8-4-9-20-18/h4,6-9,11,15H,3,5,10,12-13H2,1-2H3,(H,19,20,21) |
| InChIKey | RJKOWQJJPMZKSV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |