C15H18N4O3 — CID 172892753
5-methoxy-2-[[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]methyl]pyran-4-one (PubChem CID 172892753) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-methoxy-2-[[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]methyl]pyran-4-one.
| Compound Name | 5-methoxy-2-[[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]methyl]pyran-4-one |
|---|---|
| PubChem CID | 172892753 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-methoxy-2-[[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]methyl]pyran-4-one |
| SMILES | COc1coc(CN2CCC(Nc3ncccn3)C2)cc1=O |
| InChI | InChI=1S/C15H18N4O3/c1-21-14-10-22-12(7-13(14)20)9-19-6-3-11(8-19)18-15-16-4-2-5-17-15/h2,4-5,7,10-11H,3,6,8-9H2,1H3,(H,16,17,18) |
| InChIKey | DSAFDCUBPPFSPV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |