C19H22ClFN2O2 — CID 25378499
2-chloro-4-[[(3R)-3-(3-fluoroanilino)piperidin-1-yl]methyl]-6-methoxyphenol (PubChem CID 25378499) has the molecular formula C19H22ClFN2O2 and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-chloro-4-[[(3R)-3-(3-fluoroanilino)piperidin-1-yl]methyl]-6-methoxyphenol.
| Compound Name | 2-chloro-4-[[(3R)-3-(3-fluoroanilino)piperidin-1-yl]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 25378499 |
| Molecular Formula | C19H22ClFN2O2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-chloro-4-[[(3R)-3-(3-fluoroanilino)piperidin-1-yl]methyl]-6-methoxyphenol |
| SMILES | COc1cc(CN2CCC[C@@H](Nc3cccc(F)c3)C2)cc(Cl)c1O |
| InChI | InChI=1S/C19H22ClFN2O2/c1-25-18-9-13(8-17(20)19(18)24)11-23-7-3-6-16(12-23)22-15-5-2-4-14(21)10-15/h2,4-5,8-10,16,22,24H,3,6-7,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | FPGKEXRRMRUDIA-MRXNPFEDSA-N |
| XLogP | 4.27 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |