C20H24F2N2O2 — CID 25370484
(3R)-N-(3,4-difluorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]piperidin-3-amine (PubChem CID 25370484) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is (3R)-N-(3,4-difluorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]piperidin-3-amine.
| Compound Name | (3R)-N-(3,4-difluorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 25370484 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (3R)-N-(3,4-difluorophenyl)-1-[(3,4-dimethoxyphenyl)methyl]piperidin-3-amine |
| SMILES | COc1ccc(CN2CCC[C@@H](Nc3ccc(F)c(F)c3)C2)cc1OC |
| InChI | InChI=1S/C20H24F2N2O2/c1-25-19-8-5-14(10-20(19)26-2)12-24-9-3-4-16(13-24)23-15-6-7-17(21)18(22)11-15/h5-8,10-11,16,23H,3-4,9,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | SRTAAKJZWIGKMQ-MRXNPFEDSA-N |
| XLogP | 4.06 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |