C15H22BrNO2 — CID 80680131
3-(bromomethyl)-1-[(3,4-dimethoxyphenyl)methyl]piperidine (PubChem CID 80680131) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 3-(bromomethyl)-1-[(3,4-dimethoxyphenyl)methyl]piperidine.
| Compound Name | 3-(bromomethyl)-1-[(3,4-dimethoxyphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 80680131 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-(bromomethyl)-1-[(3,4-dimethoxyphenyl)methyl]piperidine |
| SMILES | COc1ccc(CN2CCCC(CBr)C2)cc1OC |
| InChI | InChI=1S/C15H22BrNO2/c1-18-14-6-5-12(8-15(14)19-2)10-17-7-3-4-13(9-16)11-17/h5-6,8,13H,3-4,7,9-11H2,1-2H3 |
| InChIKey | LYUJXDXWJUULRW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|