C15H24Cl2N2O — CID 120728671
2-[1-[(3-chloro-4-methoxyphenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120728671) has the molecular formula C15H24Cl2N2O and a molecular weight of 319.28 g/mol. Its IUPAC name is 2-[1-[(3-chloro-4-methoxyphenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 2-[1-[(3-chloro-4-methoxyphenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120728671 |
| Molecular Formula | C15H24Cl2N2O |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[1-[(3-chloro-4-methoxyphenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | COc1ccc(CN2CCCC(CCN)C2)cc1Cl.Cl |
| InChI | InChI=1S/C15H23ClN2O.ClH/c1-19-15-5-4-13(9-14(15)16)11-18-8-2-3-12(10-18)6-7-17;/h4-5,9,12H,2-3,6-8,10-11,17H2,1H3;1H |
| InChIKey | YQEIOPXLIPONQB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |