C20H24F2N2O2 — CID 45241710
2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-6-ethoxyphenol (PubChem CID 45241710) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-6-ethoxyphenol.
| Compound Name | 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 45241710 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[[3-(3,4-difluoroanilino)piperidin-1-yl]methyl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(CN2CCCC(Nc3ccc(F)c(F)c3)C2)c1O |
| InChI | InChI=1S/C20H24F2N2O2/c1-2-26-19-7-3-5-14(20(19)25)12-24-10-4-6-16(13-24)23-15-8-9-17(21)18(22)11-15/h3,5,7-9,11,16,23,25H,2,4,6,10,12-13H2,1H3 |
| InChIKey | YMMIGJNZEMKWNE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|