C22H29FN2O2 — CID 92770229
2-ethoxy-6-[[[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylamino]methyl]phenol (PubChem CID 92770229) has the molecular formula C22H29FN2O2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-ethoxy-6-[[[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylamino]methyl]phenol.
| Compound Name | 2-ethoxy-6-[[[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 92770229 |
| Molecular Formula | C22H29FN2O2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-ethoxy-6-[[[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylamino]methyl]phenol |
| SMILES | CCOc1cccc(CN(C)[C@@H]2CCCN(Cc3ccccc3F)C2)c1O |
| InChI | InChI=1S/C22H29FN2O2/c1-3-27-21-12-6-9-18(22(21)26)14-24(2)19-10-7-13-25(16-19)15-17-8-4-5-11-20(17)23/h4-6,8-9,11-12,19,26H,3,7,10,13-16H2,1-2H3/t19-/m1/s1 |
| InChIKey | IYSRPKGRWHOZSL-LJQANCHMSA-N |
| XLogP | 4.03 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|