C20H22F2N2O — CID 25381608
1-[3-[[(3R)-3-(3,4-difluoroanilino)piperidin-1-yl]methyl]phenyl]ethanone (PubChem CID 25381608) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[3-[[(3R)-3-(3,4-difluoroanilino)piperidin-1-yl]methyl]phenyl]ethanone.
| Compound Name | 1-[3-[[(3R)-3-(3,4-difluoroanilino)piperidin-1-yl]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 25381608 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[3-[[(3R)-3-(3,4-difluoroanilino)piperidin-1-yl]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(CN2CCC[C@@H](Nc3ccc(F)c(F)c3)C2)c1 |
| InChI | InChI=1S/C20H22F2N2O/c1-14(25)16-5-2-4-15(10-16)12-24-9-3-6-18(13-24)23-17-7-8-19(21)20(22)11-17/h2,4-5,7-8,10-11,18,23H,3,6,9,12-13H2,1H3/t18-/m1/s1 |
| InChIKey | BGKPRPDSCVBWBW-GOSISDBHSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |