C22H24FNO3 — CID 25453186
1-[3-[[(3S)-3-(5-fluoro-2-methoxybenzoyl)piperidin-1-yl]methyl]phenyl]ethanone (PubChem CID 25453186) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[3-[[(3S)-3-(5-fluoro-2-methoxybenzoyl)piperidin-1-yl]methyl]phenyl]ethanone.
| Compound Name | 1-[3-[[(3S)-3-(5-fluoro-2-methoxybenzoyl)piperidin-1-yl]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 25453186 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[3-[[(3S)-3-(5-fluoro-2-methoxybenzoyl)piperidin-1-yl]methyl]phenyl]ethanone |
| SMILES | COc1ccc(F)cc1C(=O)[C@H]1CCCN(Cc2cccc(C(C)=O)c2)C1 |
| InChI | InChI=1S/C22H24FNO3/c1-15(25)17-6-3-5-16(11-17)13-24-10-4-7-18(14-24)22(26)20-12-19(23)8-9-21(20)27-2/h3,5-6,8-9,11-12,18H,4,7,10,13-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | LWIXABVAWCSUGX-SFHVURJKSA-N |
| XLogP | 4.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |