C25H25NO2 — CID 42565190
1-[3-[[(3R)-3-(naphthalene-1-carbonyl)piperidin-1-yl]methyl]phenyl]ethanone (PubChem CID 42565190) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[3-[[(3R)-3-(naphthalene-1-carbonyl)piperidin-1-yl]methyl]phenyl]ethanone.
| Compound Name | 1-[3-[[(3R)-3-(naphthalene-1-carbonyl)piperidin-1-yl]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 42565190 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 1-[3-[[(3R)-3-(naphthalene-1-carbonyl)piperidin-1-yl]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(CN2CCC[C@@H](C(=O)c3cccc4ccccc34)C2)c1 |
| InChI | InChI=1S/C25H25NO2/c1-18(27)21-10-4-7-19(15-21)16-26-14-6-11-22(17-26)25(28)24-13-5-9-20-8-2-3-12-23(20)24/h2-5,7-10,12-13,15,22H,6,11,14,16-17H2,1H3/t22-/m1/s1 |
| InChIKey | ZPOJAJDNXPYZCB-JOCHJYFZSA-N |
| XLogP | 5.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |