C23H25N3O3 — CID 25286557
ethyl 4-[[(3S)-3-(naphthalene-1-carbonyl)piperidin-1-yl]methyl]-1H-pyrazole-5-carboxylate (PubChem CID 25286557) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl 4-[[(3S)-3-(naphthalene-1-carbonyl)piperidin-1-yl]methyl]-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[[(3S)-3-(naphthalene-1-carbonyl)piperidin-1-yl]methyl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 25286557 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | ethyl 4-[[(3S)-3-(naphthalene-1-carbonyl)piperidin-1-yl]methyl]-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]ncc1CN1CCC[C@H](C(=O)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C23H25N3O3/c1-2-29-23(28)21-18(13-24-25-21)15-26-12-6-9-17(14-26)22(27)20-11-5-8-16-7-3-4-10-19(16)20/h3-5,7-8,10-11,13,17H,2,6,9,12,14-15H2,1H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | NUNMABSCYRGOJH-KRWDZBQOSA-N |
| XLogP | 3.83 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |