C24H26FNO3 — CID 26331855
(5-fluoro-2-methoxyphenyl)-[(3R)-1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]piperidin-3-yl]methanone (PubChem CID 26331855) has the molecular formula C24H26FNO3 and a molecular weight of 395.47 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)-[(3R)-1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]piperidin-3-yl]methanone.
| Compound Name | (5-fluoro-2-methoxyphenyl)-[(3R)-1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 26331855 |
| Molecular Formula | C24H26FNO3 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)-[(3R)-1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]piperidin-3-yl]methanone |
| SMILES | COc1ccc(F)cc1C(=O)[C@@H]1CCCN(Cc2ccc(C#CCCO)cc2)C1 |
| InChI | InChI=1S/C24H26FNO3/c1-29-23-12-11-21(25)15-22(23)24(28)20-6-4-13-26(17-20)16-19-9-7-18(8-10-19)5-2-3-14-27/h7-12,15,20,27H,3-4,6,13-14,16-17H2,1H3/t20-/m1/s1 |
| InChIKey | RXRYKVDCLRXGNO-HXUWFJFHSA-N |
| XLogP | 3.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|