C24H27NO2S — CID 42383075
[(3S)-1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]piperidin-3-yl]-(4-methylsulfanylphenyl)methanone (PubChem CID 42383075) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is [(3S)-1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]piperidin-3-yl]-(4-methylsulfanylphenyl)methanone.
| Compound Name | [(3S)-1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]piperidin-3-yl]-(4-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 42383075 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [(3S)-1-[[4-(4-hydroxybut-1-ynyl)phenyl]methyl]piperidin-3-yl]-(4-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccc(C(=O)[C@H]2CCCN(Cc3ccc(C#CCCO)cc3)C2)cc1 |
| InChI | InChI=1S/C24H27NO2S/c1-28-23-13-11-21(12-14-23)24(27)22-6-4-15-25(18-22)17-20-9-7-19(8-10-20)5-2-3-16-26/h7-14,22,26H,3-4,6,15-18H2,1H3/t22-/m0/s1 |
| InChIKey | MIMTYIBBUXFDHG-QFIPXVFZSA-N |
| XLogP | 4.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|